C15H21IO — CID 115806226
(3,4-dimethylcyclohexyl)-(2-iodophenyl)methanol (PubChem CID 115806226) has the molecular formula C15H21IO and a molecular weight of 344.24 g/mol. Its IUPAC name is (3,4-dimethylcyclohexyl)-(2-iodophenyl)methanol.
| Compound Name | (3,4-dimethylcyclohexyl)-(2-iodophenyl)methanol |
|---|---|
| PubChem CID | 115806226 |
| Molecular Formula | C15H21IO |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | (3,4-dimethylcyclohexyl)-(2-iodophenyl)methanol |
| SMILES | CC1CCC(C(O)c2ccccc2I)CC1C |
| InChI | InChI=1S/C15H21IO/c1-10-7-8-12(9-11(10)2)15(17)13-5-3-4-6-14(13)16/h3-6,10-12,15,17H,7-9H2,1-2H3 |
| InChIKey | KRGUBLNCEAIWTA-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|