C11H13BrN2O2 — CID 106886253
1-(3-bromofuran-2-yl)-2-(2,5-dimethylpyrazol-3-yl)ethanol (PubChem CID 106886253) has the molecular formula C11H13BrN2O2 and a molecular weight of 285.14 g/mol. Its IUPAC name is 1-(3-bromofuran-2-yl)-2-(2,5-dimethylpyrazol-3-yl)ethanol.
| Compound Name | 1-(3-bromofuran-2-yl)-2-(2,5-dimethylpyrazol-3-yl)ethanol |
|---|---|
| PubChem CID | 106886253 |
| Molecular Formula | C11H13BrN2O2 |
| Molecular Weight | 285.14 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 1-(3-bromofuran-2-yl)-2-(2,5-dimethylpyrazol-3-yl)ethanol |
| SMILES | Cc1cc(CC(O)c2occc2Br)n(C)n1 |
| InChI | InChI=1S/C11H13BrN2O2/c1-7-5-8(14(2)13-7)6-10(15)11-9(12)3-4-16-11/h3-5,10,15H,6H2,1-2H3 |
| InChIKey | ASQSLAGVFQXIML-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.14 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |