C10H10BrNO2S — CID 63941255
1-(3-bromofuran-2-yl)-2-(4-methyl-1,3-thiazol-2-yl)ethanol (PubChem CID 63941255) has the molecular formula C10H10BrNO2S and a molecular weight of 288.17 g/mol. Its IUPAC name is 1-(3-bromofuran-2-yl)-2-(4-methyl-1,3-thiazol-2-yl)ethanol.
| Compound Name | 1-(3-bromofuran-2-yl)-2-(4-methyl-1,3-thiazol-2-yl)ethanol |
|---|---|
| PubChem CID | 63941255 |
| Molecular Formula | C10H10BrNO2S |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 286.96 |
| IUPAC Name | 1-(3-bromofuran-2-yl)-2-(4-methyl-1,3-thiazol-2-yl)ethanol |
| SMILES | Cc1csc(CC(O)c2occc2Br)n1 |
| InChI | InChI=1S/C10H10BrNO2S/c1-6-5-15-9(12-6)4-8(13)10-7(11)2-3-14-10/h2-3,5,8,13H,4H2,1H3 |
| InChIKey | ISQYNJVPEKWNDZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |