C12H10F3NOS — CID 55155228
2-(4-methyl-1,3-thiazol-2-yl)-1-(2,3,4-trifluorophenyl)ethanol (PubChem CID 55155228) has the molecular formula C12H10F3NOS and a molecular weight of 273.28 g/mol. Its IUPAC name is 2-(4-methyl-1,3-thiazol-2-yl)-1-(2,3,4-trifluorophenyl)ethanol.
| Compound Name | 2-(4-methyl-1,3-thiazol-2-yl)-1-(2,3,4-trifluorophenyl)ethanol |
|---|---|
| PubChem CID | 55155228 |
| Molecular Formula | C12H10F3NOS |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 2-(4-methyl-1,3-thiazol-2-yl)-1-(2,3,4-trifluorophenyl)ethanol |
| SMILES | Cc1csc(CC(O)c2ccc(F)c(F)c2F)n1 |
| InChI | InChI=1S/C12H10F3NOS/c1-6-5-18-10(16-6)4-9(17)7-2-3-8(13)12(15)11(7)14/h2-3,5,9,17H,4H2,1H3 |
| InChIKey | IIXZLYXMVZJVFH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|