C13H12BrF2NOS — CID 107538340
1-(2-bromo-3,4-difluorophenyl)-2-(4,5-dimethyl-1,3-thiazol-2-yl)ethanol (PubChem CID 107538340) has the molecular formula C13H12BrF2NOS and a molecular weight of 348.21 g/mol. Its IUPAC name is 1-(2-bromo-3,4-difluorophenyl)-2-(4,5-dimethyl-1,3-thiazol-2-yl)ethanol.
| Compound Name | 1-(2-bromo-3,4-difluorophenyl)-2-(4,5-dimethyl-1,3-thiazol-2-yl)ethanol |
|---|---|
| PubChem CID | 107538340 |
| Molecular Formula | C13H12BrF2NOS |
| Molecular Weight | 348.21 g/mol |
| Exact Mass | 346.98 |
| IUPAC Name | 1-(2-bromo-3,4-difluorophenyl)-2-(4,5-dimethyl-1,3-thiazol-2-yl)ethanol |
| SMILES | Cc1nc(CC(O)c2ccc(F)c(F)c2Br)sc1C |
| InChI | InChI=1S/C13H12BrF2NOS/c1-6-7(2)19-11(17-6)5-10(18)8-3-4-9(15)13(16)12(8)14/h3-4,10,18H,5H2,1-2H3 |
| InChIKey | SNNBBQJIFPFUSJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.21 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|