C12H11BrClNOS — CID 107947699
1-(3-bromo-5-chlorophenyl)-2-(4-methyl-1,3-thiazol-2-yl)ethanol (PubChem CID 107947699) has the molecular formula C12H11BrClNOS and a molecular weight of 332.65 g/mol. Its IUPAC name is 1-(3-bromo-5-chlorophenyl)-2-(4-methyl-1,3-thiazol-2-yl)ethanol.
| Compound Name | 1-(3-bromo-5-chlorophenyl)-2-(4-methyl-1,3-thiazol-2-yl)ethanol |
|---|---|
| PubChem CID | 107947699 |
| Molecular Formula | C12H11BrClNOS |
| Molecular Weight | 332.65 g/mol |
| Exact Mass | 330.94 |
| IUPAC Name | 1-(3-bromo-5-chlorophenyl)-2-(4-methyl-1,3-thiazol-2-yl)ethanol |
| SMILES | Cc1csc(CC(O)c2cc(Cl)cc(Br)c2)n1 |
| InChI | InChI=1S/C12H11BrClNOS/c1-7-6-17-12(15-7)5-11(16)8-2-9(13)4-10(14)3-8/h2-4,6,11,16H,5H2,1H3 |
| InChIKey | AIZXYDOQUDRBML-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.65 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |