C11H6F2O2 — CID 106886467
3-(3,4-difluorophenyl)furan-2-carbaldehyde (PubChem CID 106886467) has the molecular formula C11H6F2O2 and a molecular weight of 208.16 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)furan-2-carbaldehyde.
| Compound Name | 3-(3,4-difluorophenyl)furan-2-carbaldehyde |
|---|---|
| PubChem CID | 106886467 |
| Molecular Formula | C11H6F2O2 |
| Molecular Weight | 208.16 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | 3-(3,4-difluorophenyl)furan-2-carbaldehyde |
| SMILES | O=Cc1occc1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H6F2O2/c12-9-2-1-7(5-10(9)13)8-3-4-15-11(8)6-14/h1-6H |
| InChIKey | CWHGENGZTCBEJP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.16 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|