C12H8F2O2 — CID 106888482
3-(2,4-difluoro-5-methylphenyl)furan-2-carbaldehyde (PubChem CID 106888482) has the molecular formula C12H8F2O2 and a molecular weight of 222.19 g/mol. Its IUPAC name is 3-(2,4-difluoro-5-methylphenyl)furan-2-carbaldehyde.
| Compound Name | 3-(2,4-difluoro-5-methylphenyl)furan-2-carbaldehyde |
|---|---|
| PubChem CID | 106888482 |
| Molecular Formula | C12H8F2O2 |
| Molecular Weight | 222.19 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 3-(2,4-difluoro-5-methylphenyl)furan-2-carbaldehyde |
| SMILES | Cc1cc(-c2ccoc2C=O)c(F)cc1F |
| InChI | InChI=1S/C12H8F2O2/c1-7-4-9(11(14)5-10(7)13)8-2-3-16-12(8)6-15/h2-6H,1H3 |
| InChIKey | QICDFNYJKRZLPE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.19 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|