C16H10N2O7 — CID 10688650
(2,4-dinitrophenyl) 3-(4-methoxyphenyl)prop-2-ynoate (PubChem CID 10688650) has the molecular formula C16H10N2O7 and a molecular weight of 342.26 g/mol. Its IUPAC name is (2,4-dinitrophenyl) 3-(4-methoxyphenyl)prop-2-ynoate.
| Compound Name | (2,4-dinitrophenyl) 3-(4-methoxyphenyl)prop-2-ynoate |
|---|---|
| PubChem CID | 10688650 |
| Molecular Formula | C16H10N2O7 |
| Molecular Weight | 342.26 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | (2,4-dinitrophenyl) 3-(4-methoxyphenyl)prop-2-ynoate |
| SMILES | COc1ccc(C#CC(=O)Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H10N2O7/c1-24-13-6-2-11(3-7-13)4-9-16(19)25-15-8-5-12(17(20)21)10-14(15)18(22)23/h2-3,5-8,10H,1H3 |
| InChIKey | LZRUBBCKSCPIJD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 121.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.26 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|