C12H13Cl2N3O2 — CID 106891217
3-(2,6-dichloro-N-ethyl-4-nitroanilino)-2-methylpropanenitrile (PubChem CID 106891217) has the molecular formula C12H13Cl2N3O2 and a molecular weight of 302.16 g/mol. Its IUPAC name is 3-(2,6-dichloro-N-ethyl-4-nitroanilino)-2-methylpropanenitrile.
| Compound Name | 3-(2,6-dichloro-N-ethyl-4-nitroanilino)-2-methylpropanenitrile |
|---|---|
| PubChem CID | 106891217 |
| Molecular Formula | C12H13Cl2N3O2 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 3-(2,6-dichloro-N-ethyl-4-nitroanilino)-2-methylpropanenitrile |
| SMILES | CCN(CC(C)C#N)c1c(Cl)cc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C12H13Cl2N3O2/c1-3-16(7-8(2)6-15)12-10(13)4-9(17(18)19)5-11(12)14/h4-5,8H,3,7H2,1-2H3 |
| InChIKey | GYYYKEQRFZBBRV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 70.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|