C12H11F5N2 — CID 54988147
3-(N-ethyl-2,3,4,5,6-pentafluoroanilino)-2-methylpropanenitrile (PubChem CID 54988147) has the molecular formula C12H11F5N2 and a molecular weight of 278.22 g/mol. Its IUPAC name is 3-(N-ethyl-2,3,4,5,6-pentafluoroanilino)-2-methylpropanenitrile.
| Compound Name | 3-(N-ethyl-2,3,4,5,6-pentafluoroanilino)-2-methylpropanenitrile |
|---|---|
| PubChem CID | 54988147 |
| Molecular Formula | C12H11F5N2 |
| Molecular Weight | 278.22 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 3-(N-ethyl-2,3,4,5,6-pentafluoroanilino)-2-methylpropanenitrile |
| SMILES | CCN(CC(C)C#N)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H11F5N2/c1-3-19(5-6(2)4-18)12-10(16)8(14)7(13)9(15)11(12)17/h6H,3,5H2,1-2H3 |
| InChIKey | OHRLLCNFPFIQSO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.22 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|