(2E)-3-bromo-N-hydroxythiophene-2-carboximidoyl chloride

C5H3BrClNOS — CID 106892123

IUPAC(2E)-3-bromo-N-hydroxythiophene-2-carboximidoyl chloride
SMILESO/N=C(/Cl)c1sccc1Br
InChIInChI=1S/C5H3BrClNOS/c6-3-1-2-10-4(3)5(7)8-9/h1-2,9H/b8-5+
InChIKeyYSKBAOHPGZLQSO-VMPITWQZSA-N
MW240.51 g/mol
LogP2.89
Rot. Bonds1

About (2E)-3-bromo-N-hydroxythiophene-2-carboximidoyl chloride

(2E)-3-bromo-N-hydroxythiophene-2-carboximidoyl chloride (PubChem CID 106892123) has the molecular formula C5H3BrClNOS and a molecular weight of 240.51 g/mol. Its IUPAC name is (2E)-3-bromo-N-hydroxythiophene-2-carboximidoyl chloride.

Molecular Properties

Compound Name(2E)-3-bromo-N-hydroxythiophene-2-carboximidoyl chloride
PubChem CID106892123
Molecular FormulaC5H3BrClNOS
Molecular Weight240.51 g/mol
Exact Mass238.88
IUPAC Name(2E)-3-bromo-N-hydroxythiophene-2-carboximidoyl chloride
SMILESO/N=C(/Cl)c1sccc1Br
InChIInChI=1S/C5H3BrClNOS/c6-3-1-2-10-4(3)5(7)8-9/h1-2,9H/b8-5+
InChIKeyYSKBAOHPGZLQSO-VMPITWQZSA-N
XLogP2.89
TPSA32.59 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.51
LogP ≤ 52.89
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (2E)-3-bromo-N-hydroxythiophene-2-carboximidoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2E)-3-bromo-N-hydroxythiophene-2-carboximidoyl chloride?
The IUPAC name of (2E)-3-bromo-N-hydroxythiophene-2-carboximidoyl chloride (CID 106892123) is (2E)-3-bromo-N-hydroxythiophene-2-carboximidoyl chloride.
What is the SMILES notation for (2E)-3-bromo-N-hydroxythiophene-2-carboximidoyl chloride?
The canonical SMILES for (2E)-3-bromo-N-hydroxythiophene-2-carboximidoyl chloride is O/N=C(/Cl)c1sccc1Br.
What is the InChIKey of (2E)-3-bromo-N-hydroxythiophene-2-carboximidoyl chloride?
The InChIKey is YSKBAOHPGZLQSO-VMPITWQZSA-N. The full InChI is InChI=1S/C5H3BrClNOS/c6-3-1-2-10-4(3)5(7)8-9/h1-2,9H/b8-5+.
What are the key properties of (2E)-3-bromo-N-hydroxythiophene-2-carboximidoyl chloride?
(2E)-3-bromo-N-hydroxythiophene-2-carboximidoyl chloride has a molecular weight of 240.51 g/mol, XLogP of 2.89, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-3-bromo-N-hydroxythiophene-2-carboximidoyl chloride is sourced from PubChem (CID 106892123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).