3-bromothiophene-2-carbonyl chloride

C5H2BrClOS — CID 2797569

IUPAC3-bromothiophene-2-carbonyl chloride
SMILESO=C(Cl)c1sccc1Br
InChIInChI=1S/C5H2BrClOS/c6-3-1-2-9-4(3)5(7)8/h1-2H
InChIKeyQMKGMTULPADQDK-UHFFFAOYSA-N
MW225.49 g/mol
LogP2.89
Rot. Bonds1

About 3-bromothiophene-2-carbonyl chloride

3-bromothiophene-2-carbonyl chloride (PubChem CID 2797569) has the molecular formula C5H2BrClOS and a molecular weight of 225.49 g/mol. Its IUPAC name is 3-bromothiophene-2-carbonyl chloride.

Molecular Properties

Compound Name3-bromothiophene-2-carbonyl chloride
PubChem CID2797569
Molecular FormulaC5H2BrClOS
Molecular Weight225.49 g/mol
Exact Mass223.87
IUPAC Name3-bromothiophene-2-carbonyl chloride
SMILESO=C(Cl)c1sccc1Br
InChIInChI=1S/C5H2BrClOS/c6-3-1-2-9-4(3)5(7)8/h1-2H
InChIKeyQMKGMTULPADQDK-UHFFFAOYSA-N
XLogP2.89
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.49
LogP ≤ 52.89
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 3-bromothiophene-2-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-bromothiophene-2-carbonyl chloride?
The IUPAC name of 3-bromothiophene-2-carbonyl chloride (CID 2797569) is 3-bromothiophene-2-carbonyl chloride.
What is the SMILES notation for 3-bromothiophene-2-carbonyl chloride?
The canonical SMILES for 3-bromothiophene-2-carbonyl chloride is O=C(Cl)c1sccc1Br.
What is the InChIKey of 3-bromothiophene-2-carbonyl chloride?
The InChIKey is QMKGMTULPADQDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2BrClOS/c6-3-1-2-9-4(3)5(7)8/h1-2H.
What are the key properties of 3-bromothiophene-2-carbonyl chloride?
3-bromothiophene-2-carbonyl chloride has a molecular weight of 225.49 g/mol, XLogP of 2.89, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromothiophene-2-carbonyl chloride is sourced from PubChem (CID 2797569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).