C12H20N4 — CID 106897572
4-methyl-1-(pyridazin-3-ylmethyl)-1,5-diazocane (PubChem CID 106897572) has the molecular formula C12H20N4 and a molecular weight of 220.32 g/mol. Its IUPAC name is 4-methyl-1-(pyridazin-3-ylmethyl)-1,5-diazocane.
| Compound Name | 4-methyl-1-(pyridazin-3-ylmethyl)-1,5-diazocane |
|---|---|
| PubChem CID | 106897572 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | 4-methyl-1-(pyridazin-3-ylmethyl)-1,5-diazocane |
| SMILES | CC1CCN(Cc2cccnn2)CCCN1 |
| InChI | InChI=1S/C12H20N4/c1-11-5-9-16(8-3-6-13-11)10-12-4-2-7-14-15-12/h2,4,7,11,13H,3,5-6,8-10H2,1H3 |
| InChIKey | SDEWQFVUOILKKO-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |