C21H28O5 — CID 10689878
(3,3,6,9,9-pentamethyl-1,7-dioxo-2,4,8,10-tetrahydrobenzo[c]chromen-6-yl)methyl acetate (PubChem CID 10689878) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is (3,3,6,9,9-pentamethyl-1,7-dioxo-2,4,8,10-tetrahydrobenzo[c]chromen-6-yl)methyl acetate.
| Compound Name | (3,3,6,9,9-pentamethyl-1,7-dioxo-2,4,8,10-tetrahydrobenzo[c]chromen-6-yl)methyl acetate |
|---|---|
| PubChem CID | 10689878 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | (3,3,6,9,9-pentamethyl-1,7-dioxo-2,4,8,10-tetrahydrobenzo[c]chromen-6-yl)methyl acetate |
| SMILES | CC(=O)OCC1(C)OC2=C(C(=O)CC(C)(C)C2)C2=C1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C21H28O5/c1-12(22)25-11-21(6)18-13(7-19(2,3)9-15(18)24)17-14(23)8-20(4,5)10-16(17)26-21/h7-11H2,1-6H3 |
| InChIKey | HVPWWBLUHUVZAL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |