C19H24O8 — CID 102258170
2-O,3-O-diethyl 4-O-methyl 7,7-dimethyl-5-oxo-6,8-dihydro-2H-chromene-2,3,4-tricarboxylate (PubChem CID 102258170) has the molecular formula C19H24O8 and a molecular weight of 380.39 g/mol. Its IUPAC name is 2-O,3-O-diethyl 4-O-methyl 7,7-dimethyl-5-oxo-6,8-dihydro-2H-chromene-2,3,4-tricarboxylate.
| Compound Name | 2-O,3-O-diethyl 4-O-methyl 7,7-dimethyl-5-oxo-6,8-dihydro-2H-chromene-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 102258170 |
| Molecular Formula | C19H24O8 |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 2-O,3-O-diethyl 4-O-methyl 7,7-dimethyl-5-oxo-6,8-dihydro-2H-chromene-2,3,4-tricarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OC)C2=C(CC(C)(C)CC2=O)OC1C(=O)OCC |
| InChI | InChI=1S/C19H24O8/c1-6-25-17(22)14-13(16(21)24-5)12-10(20)8-19(3,4)9-11(12)27-15(14)18(23)26-7-2/h15H,6-9H2,1-5H3 |
| InChIKey | QCVJVZFABLFBLG-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|