C23H30O10 — CID 11305845
tetraethyl 1,4-dimethyl-3-oxo-5,8-dihydroisochromene-6,6,7,7-tetracarboxylate (PubChem CID 11305845) has the molecular formula C23H30O10 and a molecular weight of 466.48 g/mol. Its IUPAC name is tetraethyl 1,4-dimethyl-3-oxo-5,8-dihydroisochromene-6,6,7,7-tetracarboxylate.
| Compound Name | tetraethyl 1,4-dimethyl-3-oxo-5,8-dihydroisochromene-6,6,7,7-tetracarboxylate |
|---|---|
| PubChem CID | 11305845 |
| Molecular Formula | C23H30O10 |
| Molecular Weight | 466.48 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | tetraethyl 1,4-dimethyl-3-oxo-5,8-dihydroisochromene-6,6,7,7-tetracarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)Cc2c(C)oc(=O)c(C)c2CC1(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C23H30O10/c1-7-29-18(25)22(19(26)30-8-2)11-15-13(5)17(24)33-14(6)16(15)12-23(22,20(27)31-9-3)21(28)32-10-4/h7-12H2,1-6H3 |
| InChIKey | FPAJGGNOSVZCIW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 135.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.48 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|