C14H12BrNO2 — CID 106899069
2-bromo-N-(2,3-dihydro-1H-inden-2-yl)furan-3-carboxamide (PubChem CID 106899069) has the molecular formula C14H12BrNO2 and a molecular weight of 306.16 g/mol. Its IUPAC name is 2-bromo-N-(2,3-dihydro-1H-inden-2-yl)furan-3-carboxamide.
| Compound Name | 2-bromo-N-(2,3-dihydro-1H-inden-2-yl)furan-3-carboxamide |
|---|---|
| PubChem CID | 106899069 |
| Molecular Formula | C14H12BrNO2 |
| Molecular Weight | 306.16 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 2-bromo-N-(2,3-dihydro-1H-inden-2-yl)furan-3-carboxamide |
| SMILES | O=C(NC1Cc2ccccc2C1)c1ccoc1Br |
| InChI | InChI=1S/C14H12BrNO2/c15-13-12(5-6-18-13)14(17)16-11-7-9-3-1-2-4-10(9)8-11/h1-6,11H,7-8H2,(H,16,17) |
| InChIKey | HYMRSYFGCWCADM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.16 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |