C15H20F3NO4Si — CID 10690077
2-trimethylsilylethyl 3-methoxy-4-[(2,2,2-trifluoroacetyl)amino]benzoate (PubChem CID 10690077) has the molecular formula C15H20F3NO4Si and a molecular weight of 363.41 g/mol. Its IUPAC name is 2-trimethylsilylethyl 3-methoxy-4-[(2,2,2-trifluoroacetyl)amino]benzoate.
| Compound Name | 2-trimethylsilylethyl 3-methoxy-4-[(2,2,2-trifluoroacetyl)amino]benzoate |
|---|---|
| PubChem CID | 10690077 |
| Molecular Formula | C15H20F3NO4Si |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 2-trimethylsilylethyl 3-methoxy-4-[(2,2,2-trifluoroacetyl)amino]benzoate |
| SMILES | COc1cc(C(=O)OCC[Si](C)(C)C)ccc1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C15H20F3NO4Si/c1-22-12-9-10(13(20)23-7-8-24(2,3)4)5-6-11(12)19-14(21)15(16,17)18/h5-6,9H,7-8H2,1-4H3,(H,19,21) |
| InChIKey | JASOCGUOMWOUAI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|