C13H18BrNO4S — CID 10690119
3-(4-bromophenyl)sulfonyl-N-hydroxyheptanamide (PubChem CID 10690119) has the molecular formula C13H18BrNO4S and a molecular weight of 364.26 g/mol. Its IUPAC name is 3-(4-bromophenyl)sulfonyl-N-hydroxyheptanamide.
| Compound Name | 3-(4-bromophenyl)sulfonyl-N-hydroxyheptanamide |
|---|---|
| PubChem CID | 10690119 |
| Molecular Formula | C13H18BrNO4S |
| Molecular Weight | 364.26 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | 3-(4-bromophenyl)sulfonyl-N-hydroxyheptanamide |
| SMILES | CCCCC(CC(=O)NO)S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H18BrNO4S/c1-2-3-4-12(9-13(16)15-17)20(18,19)11-7-5-10(14)6-8-11/h5-8,12,17H,2-4,9H2,1H3,(H,15,16) |
| InChIKey | JKKBPRKOAWXEMP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|