C12H15N5O3 — CID 106909437
6-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]pyridine-2-carbohydrazide (PubChem CID 106909437) has the molecular formula C12H15N5O3 and a molecular weight of 277.28 g/mol. Its IUPAC name is 6-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]pyridine-2-carbohydrazide.
| Compound Name | 6-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 106909437 |
| Molecular Formula | C12H15N5O3 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 6-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]pyridine-2-carbohydrazide |
| SMILES | CC1(C)NC(=O)N(Cc2cccc(C(=O)NN)n2)C1=O |
| InChI | InChI=1S/C12H15N5O3/c1-12(2)10(19)17(11(20)15-12)6-7-4-3-5-8(14-7)9(18)16-13/h3-5H,6,13H2,1-2H3,(H,15,20)(H,16,18) |
| InChIKey | IZUVUUBPUBJRBH-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|