C19H24ClN3O3 — CID 10691019
1-[(1S,5R)-3-[(E)-3-(2-chloro-5-nitrophenyl)prop-2-enyl]-3,9-diazabicyclo[3.3.1]nonan-9-yl]propan-1-one (PubChem CID 10691019) has the molecular formula C19H24ClN3O3 and a molecular weight of 377.87 g/mol. Its IUPAC name is 1-[(1S,5R)-3-[(E)-3-(2-chloro-5-nitrophenyl)prop-2-enyl]-3,9-diazabicyclo[3.3.1]nonan-9-yl]propan-1-one.
| Compound Name | 1-[(1S,5R)-3-[(E)-3-(2-chloro-5-nitrophenyl)prop-2-enyl]-3,9-diazabicyclo[3.3.1]nonan-9-yl]propan-1-one |
|---|---|
| PubChem CID | 10691019 |
| Molecular Formula | C19H24ClN3O3 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 1-[(1S,5R)-3-[(E)-3-(2-chloro-5-nitrophenyl)prop-2-enyl]-3,9-diazabicyclo[3.3.1]nonan-9-yl]propan-1-one |
| SMILES | CCC(=O)N1[C@@H]2CCC[C@H]1CN(C/C=C/c1cc([N+](=O)[O-])ccc1Cl)C2 |
| InChI | InChI=1S/C19H24ClN3O3/c1-2-19(24)22-16-6-3-7-17(22)13-21(12-16)10-4-5-14-11-15(23(25)26)8-9-18(14)20/h4-5,8-9,11,16-17H,2-3,6-7,10,12-13H2,1H3/b5-4+/t16-,17+ |
| InChIKey | DOCFEAZJDQNICB-PSUYNTKASA-N |
| XLogP | 3.74 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|