C20H26O7 — CID 10691047
diethyl 2-[(E,5S)-5-phenoxycarbonyloxyhex-3-enyl]propanedioate (PubChem CID 10691047) has the molecular formula C20H26O7 and a molecular weight of 378.42 g/mol. Its IUPAC name is diethyl 2-[(E,5S)-5-phenoxycarbonyloxyhex-3-enyl]propanedioate.
| Compound Name | diethyl 2-[(E,5S)-5-phenoxycarbonyloxyhex-3-enyl]propanedioate |
|---|---|
| PubChem CID | 10691047 |
| Molecular Formula | C20H26O7 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | diethyl 2-[(E,5S)-5-phenoxycarbonyloxyhex-3-enyl]propanedioate |
| SMILES | CCOC(=O)C(CC/C=C/[C@H](C)OC(=O)Oc1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C20H26O7/c1-4-24-18(21)17(19(22)25-5-2)14-10-9-11-15(3)26-20(23)27-16-12-7-6-8-13-16/h6-9,11-13,15,17H,4-5,10,14H2,1-3H3/b11-9+/t15-/m0/s1 |
| InChIKey | OJUCASKKTJQBSI-GDXASINISA-N |
| XLogP | 3.67 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|