About diethyl 2-[(E,5S)-5-phenoxycarbonyloxyhex-3-enyl]propanedioate
diethyl 2-[(E,5S)-5-phenoxycarbonyloxyhex-3-enyl]propanedioate (PubChem CID 10691047) has the molecular formula C20H26O7
and a molecular weight of 378.42 g/mol. Its IUPAC name is diethyl 2-[(E,5S)-5-phenoxycarbonyloxyhex-3-enyl]propanedioate.
Molecular Properties
| Compound Name | diethyl 2-[(E,5S)-5-phenoxycarbonyloxyhex-3-enyl]propanedioate |
| PubChem CID | 10691047 |
| Molecular Formula | C20H26O7 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | diethyl 2-[(E,5S)-5-phenoxycarbonyloxyhex-3-enyl]propanedioate |
| SMILES | CCOC(=O)C(CC/C=C/[C@H](C)OC(=O)Oc1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C20H26O7/c1-4-24-18(21)17(19(22)25-5-2)14-10-9-11-15(3)26-20(23)27-16-12-7-6-8-13-16/h6-9,11-13,15,17H,4-5,10,14H2,1-3H3/b11-9+/t15-/m0/s1 |
| InChIKey | OJUCASKKTJQBSI-GDXASINISA-N |
| XLogP | 3.67 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-[(E,5S)-5-phenoxycarbonyloxyhex-3-enyl]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-[(E,5S)-5-phenoxycarbonyloxyhex-3-enyl]propanedioate?
The IUPAC name of diethyl 2-[(E,5S)-5-phenoxycarbonyloxyhex-3-enyl]propanedioate (CID 10691047) is diethyl 2-[(E,5S)-5-phenoxycarbonyloxyhex-3-enyl]propanedioate.
What is the SMILES notation for diethyl 2-[(E,5S)-5-phenoxycarbonyloxyhex-3-enyl]propanedioate?
The canonical SMILES for diethyl 2-[(E,5S)-5-phenoxycarbonyloxyhex-3-enyl]propanedioate is CCOC(=O)C(CC/C=C/[C@H](C)OC(=O)Oc1ccccc1)C(=O)OCC.
What is the InChIKey of diethyl 2-[(E,5S)-5-phenoxycarbonyloxyhex-3-enyl]propanedioate?
The InChIKey is OJUCASKKTJQBSI-GDXASINISA-N. The full InChI is InChI=1S/C20H26O7/c1-4-24-18(21)17(19(22)25-5-2)14-10-9-11-15(3)26-20(23)27-16-12-7-6-8-13-16/h6-9,11-13,15,17H,4-5,10,14H2,1-3H3/b11-9+/t15-/m0/s1.
What are the key properties of diethyl 2-[(E,5S)-5-phenoxycarbonyloxyhex-3-enyl]propanedioate?
diethyl 2-[(E,5S)-5-phenoxycarbonyloxyhex-3-enyl]propanedioate has a molecular weight of 378.42 g/mol, XLogP of 3.67, 10 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-[(E,5S)-5-phenoxycarbonyloxyhex-3-enyl]propanedioate is sourced from PubChem (CID 10691047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).