C23H40O4 — CID 10691219
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[(E)-hex-2-enoxy]-2-(1-hydroxycyclopentyl)acetate (PubChem CID 10691219) has the molecular formula C23H40O4 and a molecular weight of 380.57 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[(E)-hex-2-enoxy]-2-(1-hydroxycyclopentyl)acetate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[(E)-hex-2-enoxy]-2-(1-hydroxycyclopentyl)acetate |
|---|---|
| PubChem CID | 10691219 |
| Molecular Formula | C23H40O4 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[(E)-hex-2-enoxy]-2-(1-hydroxycyclopentyl)acetate |
| SMILES | CCC/C=C/COC(C(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C)C1(O)CCCC1 |
| InChI | InChI=1S/C23H40O4/c1-5-6-7-10-15-26-21(23(25)13-8-9-14-23)22(24)27-20-16-18(4)11-12-19(20)17(2)3/h7,10,17-21,25H,5-6,8-9,11-16H2,1-4H3/b10-7+/t18-,19+,20-,21?/m1/s1 |
| InChIKey | NJIWTGOIVXCGCV-VGMJVHOVSA-N |
| XLogP | 5.04 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|