C21H38O4 — CID 10736876
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[(Z)-hex-2-enoxy]-3-hydroxy-3-methylbutanoate (PubChem CID 10736876) has the molecular formula C21H38O4 and a molecular weight of 354.53 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[(Z)-hex-2-enoxy]-3-hydroxy-3-methylbutanoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[(Z)-hex-2-enoxy]-3-hydroxy-3-methylbutanoate |
|---|---|
| PubChem CID | 10736876 |
| Molecular Formula | C21H38O4 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.28 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[(Z)-hex-2-enoxy]-3-hydroxy-3-methylbutanoate |
| SMILES | CCC/C=C\COC(C(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C)C(C)(C)O |
| InChI | InChI=1S/C21H38O4/c1-7-8-9-10-13-24-19(21(5,6)23)20(22)25-18-14-16(4)11-12-17(18)15(2)3/h9-10,15-19,23H,7-8,11-14H2,1-6H3/b10-9-/t16-,17+,18-,19?/m1/s1 |
| InChIKey | XHSVPUDHRIJLLM-DOKQNUFTSA-N |
| XLogP | 4.50 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|