C9H17BrN2O2 — CID 106915052
2-bromo-N,2-dimethyl-N-[3-(methylamino)-3-oxopropyl]propanamide (PubChem CID 106915052) has the molecular formula C9H17BrN2O2 and a molecular weight of 265.15 g/mol. Its IUPAC name is 2-bromo-N,2-dimethyl-N-[3-(methylamino)-3-oxopropyl]propanamide.
| Compound Name | 2-bromo-N,2-dimethyl-N-[3-(methylamino)-3-oxopropyl]propanamide |
|---|---|
| PubChem CID | 106915052 |
| Molecular Formula | C9H17BrN2O2 |
| Molecular Weight | 265.15 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 2-bromo-N,2-dimethyl-N-[3-(methylamino)-3-oxopropyl]propanamide |
| SMILES | CNC(=O)CCN(C)C(=O)C(C)(C)Br |
| InChI | InChI=1S/C9H17BrN2O2/c1-9(2,10)8(14)12(4)6-5-7(13)11-3/h5-6H2,1-4H3,(H,11,13) |
| InChIKey | CJAXAXBLQUFFQP-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.15 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|