C8H16N2O4 — CID 106918325
2-hydroxyethyl N-methyl-N-[3-(methylamino)-3-oxopropyl]carbamate (PubChem CID 106918325) has the molecular formula C8H16N2O4 and a molecular weight of 204.23 g/mol. Its IUPAC name is 2-hydroxyethyl N-methyl-N-[3-(methylamino)-3-oxopropyl]carbamate.
| Compound Name | 2-hydroxyethyl N-methyl-N-[3-(methylamino)-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 106918325 |
| Molecular Formula | C8H16N2O4 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 2-hydroxyethyl N-methyl-N-[3-(methylamino)-3-oxopropyl]carbamate |
| SMILES | CNC(=O)CCN(C)C(=O)OCCO |
| InChI | InChI=1S/C8H16N2O4/c1-9-7(12)3-4-10(2)8(13)14-6-5-11/h11H,3-6H2,1-2H3,(H,9,12) |
| InChIKey | ALISRTBONKLFPK-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |