C8H14N4OS — CID 106915473
methyl N'-cyano-N-methyl-N-[3-(methylamino)-3-oxopropyl]carbamimidothioate (PubChem CID 106915473) has the molecular formula C8H14N4OS and a molecular weight of 214.29 g/mol. Its IUPAC name is methyl N'-cyano-N-methyl-N-[3-(methylamino)-3-oxopropyl]carbamimidothioate.
| Compound Name | methyl N'-cyano-N-methyl-N-[3-(methylamino)-3-oxopropyl]carbamimidothioate |
|---|---|
| PubChem CID | 106915473 |
| Molecular Formula | C8H14N4OS |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | methyl N'-cyano-N-methyl-N-[3-(methylamino)-3-oxopropyl]carbamimidothioate |
| SMILES | CNC(=O)CCN(C)/C(=N/C#N)SC |
| InChI | InChI=1S/C8H14N4OS/c1-10-7(13)4-5-12(2)8(14-3)11-6-9/h4-5H2,1-3H3,(H,10,13)/b11-8- |
| InChIKey | GJYRMGWRNYKQBC-FLIBITNWSA-N |
| XLogP | 0.25 |
| TPSA | 68.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|