C12H24N2O5 — CID 118657519
methyl 3-[2-(2-hydroxyethoxy)ethyl-[3-(methylamino)-3-oxopropyl]amino]propanoate (PubChem CID 118657519) has the molecular formula C12H24N2O5 and a molecular weight of 276.33 g/mol. Its IUPAC name is methyl 3-[2-(2-hydroxyethoxy)ethyl-[3-(methylamino)-3-oxopropyl]amino]propanoate.
| Compound Name | methyl 3-[2-(2-hydroxyethoxy)ethyl-[3-(methylamino)-3-oxopropyl]amino]propanoate |
|---|---|
| PubChem CID | 118657519 |
| Molecular Formula | C12H24N2O5 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | methyl 3-[2-(2-hydroxyethoxy)ethyl-[3-(methylamino)-3-oxopropyl]amino]propanoate |
| SMILES | CNC(=O)CCN(CCOCCO)CCC(=O)OC |
| InChI | InChI=1S/C12H24N2O5/c1-13-11(16)3-5-14(6-4-12(17)18-2)7-9-19-10-8-15/h15H,3-10H2,1-2H3,(H,13,16) |
| InChIKey | KXDADKKNEQQAIX-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|