C11H18BrNOS — CID 106921044
2-[2-(bromomethyl)-3-methylbutyl]sulfanyl-4,5-dimethyl-1,3-oxazole (PubChem CID 106921044) has the molecular formula C11H18BrNOS and a molecular weight of 292.24 g/mol. Its IUPAC name is 2-[2-(bromomethyl)-3-methylbutyl]sulfanyl-4,5-dimethyl-1,3-oxazole.
| Compound Name | 2-[2-(bromomethyl)-3-methylbutyl]sulfanyl-4,5-dimethyl-1,3-oxazole |
|---|---|
| PubChem CID | 106921044 |
| Molecular Formula | C11H18BrNOS |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 2-[2-(bromomethyl)-3-methylbutyl]sulfanyl-4,5-dimethyl-1,3-oxazole |
| SMILES | Cc1nc(SCC(CBr)C(C)C)oc1C |
| InChI | InChI=1S/C11H18BrNOS/c1-7(2)10(5-12)6-15-11-13-8(3)9(4)14-11/h7,10H,5-6H2,1-4H3 |
| InChIKey | YSSLNYZIRBDQMT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|