C12H20BrNOS — CID 106921043
2-[2-(bromomethyl)-2-ethylbutyl]sulfanyl-4,5-dimethyl-1,3-oxazole (PubChem CID 106921043) has the molecular formula C12H20BrNOS and a molecular weight of 306.27 g/mol. Its IUPAC name is 2-[2-(bromomethyl)-2-ethylbutyl]sulfanyl-4,5-dimethyl-1,3-oxazole.
| Compound Name | 2-[2-(bromomethyl)-2-ethylbutyl]sulfanyl-4,5-dimethyl-1,3-oxazole |
|---|---|
| PubChem CID | 106921043 |
| Molecular Formula | C12H20BrNOS |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 2-[2-(bromomethyl)-2-ethylbutyl]sulfanyl-4,5-dimethyl-1,3-oxazole |
| SMILES | CCC(CC)(CBr)CSc1nc(C)c(C)o1 |
| InChI | InChI=1S/C12H20BrNOS/c1-5-12(6-2,7-13)8-16-11-14-9(3)10(4)15-11/h5-8H2,1-4H3 |
| InChIKey | FAASKEHMRLZUPH-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|