C13H17N5O — CID 106934374
4-amino-N,5-diethyl-N-pyridin-4-yl-1H-pyrazole-3-carboxamide (PubChem CID 106934374) has the molecular formula C13H17N5O and a molecular weight of 259.31 g/mol. Its IUPAC name is 4-amino-N,5-diethyl-N-pyridin-4-yl-1H-pyrazole-3-carboxamide.
| Compound Name | 4-amino-N,5-diethyl-N-pyridin-4-yl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 106934374 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 4-amino-N,5-diethyl-N-pyridin-4-yl-1H-pyrazole-3-carboxamide |
| SMILES | CCc1[nH]nc(C(=O)N(CC)c2ccncc2)c1N |
| InChI | InChI=1S/C13H17N5O/c1-3-10-11(14)12(17-16-10)13(19)18(4-2)9-5-7-15-8-6-9/h5-8H,3-4,14H2,1-2H3,(H,16,17) |
| InChIKey | QASAWUARXWBDNH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |