C14H20N4OS — CID 62080802
4-amino-5-ethyl-N-propan-2-yl-N-(thiophen-2-ylmethyl)-1H-pyrazole-3-carboxamide (PubChem CID 62080802) has the molecular formula C14H20N4OS and a molecular weight of 292.41 g/mol. Its IUPAC name is 4-amino-5-ethyl-N-propan-2-yl-N-(thiophen-2-ylmethyl)-1H-pyrazole-3-carboxamide.
| Compound Name | 4-amino-5-ethyl-N-propan-2-yl-N-(thiophen-2-ylmethyl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 62080802 |
| Molecular Formula | C14H20N4OS |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 4-amino-5-ethyl-N-propan-2-yl-N-(thiophen-2-ylmethyl)-1H-pyrazole-3-carboxamide |
| SMILES | CCc1[nH]nc(C(=O)N(Cc2cccs2)C(C)C)c1N |
| InChI | InChI=1S/C14H20N4OS/c1-4-11-12(15)13(17-16-11)14(19)18(9(2)3)8-10-6-5-7-20-10/h5-7,9H,4,8,15H2,1-3H3,(H,16,17) |
| InChIKey | CIDLRFOOCNBBFZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |