C20H13ClN6OS — CID 10693458
2-(4-amino-3-cyanopyrido[3,2-b]quinoxalin-2-yl)sulfanyl-N-(4-chlorophenyl)acetamide (PubChem CID 10693458) has the molecular formula C20H13ClN6OS and a molecular weight of 420.89 g/mol. Its IUPAC name is 2-(4-amino-3-cyanopyrido[3,2-b]quinoxalin-2-yl)sulfanyl-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-(4-amino-3-cyanopyrido[3,2-b]quinoxalin-2-yl)sulfanyl-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 10693458 |
| Molecular Formula | C20H13ClN6OS |
| Molecular Weight | 420.89 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | 2-(4-amino-3-cyanopyrido[3,2-b]quinoxalin-2-yl)sulfanyl-N-(4-chlorophenyl)acetamide |
| SMILES | N#Cc1c(SCC(=O)Nc2ccc(Cl)cc2)nc2nc3ccccc3nc2c1N |
| InChI | InChI=1S/C20H13ClN6OS/c21-11-5-7-12(8-6-11)24-16(28)10-29-20-13(9-22)17(23)18-19(27-20)26-15-4-2-1-3-14(15)25-18/h1-8H,10H2,(H,24,28)(H2,23,26,27) |
| InChIKey | MFOBRWDZPRFPCU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.89 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|