C13H21F2N3O — CID 106938434
[2-[[1-(difluoromethyl)imidazol-2-yl]methoxymethyl]cyclohexyl]methanamine (PubChem CID 106938434) has the molecular formula C13H21F2N3O and a molecular weight of 273.33 g/mol. Its IUPAC name is [2-[[1-(difluoromethyl)imidazol-2-yl]methoxymethyl]cyclohexyl]methanamine.
| Compound Name | [2-[[1-(difluoromethyl)imidazol-2-yl]methoxymethyl]cyclohexyl]methanamine |
|---|---|
| PubChem CID | 106938434 |
| Molecular Formula | C13H21F2N3O |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | [2-[[1-(difluoromethyl)imidazol-2-yl]methoxymethyl]cyclohexyl]methanamine |
| SMILES | NCC1CCCCC1COCc1nccn1C(F)F |
| InChI | InChI=1S/C13H21F2N3O/c14-13(15)18-6-5-17-12(18)9-19-8-11-4-2-1-3-10(11)7-16/h5-6,10-11,13H,1-4,7-9,16H2 |
| InChIKey | RMNWYTPGWMUGBF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |