C13H18F3NO2 — CID 106939047
N-benzyl-3-(2,2,2-trifluoroethoxymethoxy)propan-1-amine (PubChem CID 106939047) has the molecular formula C13H18F3NO2 and a molecular weight of 277.29 g/mol. Its IUPAC name is N-benzyl-3-(2,2,2-trifluoroethoxymethoxy)propan-1-amine.
| Compound Name | N-benzyl-3-(2,2,2-trifluoroethoxymethoxy)propan-1-amine |
|---|---|
| PubChem CID | 106939047 |
| Molecular Formula | C13H18F3NO2 |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | N-benzyl-3-(2,2,2-trifluoroethoxymethoxy)propan-1-amine |
| SMILES | FC(F)(F)COCOCCCNCc1ccccc1 |
| InChI | InChI=1S/C13H18F3NO2/c14-13(15,16)10-19-11-18-8-4-7-17-9-12-5-2-1-3-6-12/h1-3,5-6,17H,4,7-11H2 |
| InChIKey | ZDPKGRXPYLVVNU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|