C14H16BrF2N3 — CID 106944585
1-(3-bromo-2,6-difluorophenyl)-2-(1,3,5-trimethylpyrazol-4-yl)ethanamine (PubChem CID 106944585) has the molecular formula C14H16BrF2N3 and a molecular weight of 344.20 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-2-(1,3,5-trimethylpyrazol-4-yl)ethanamine.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-2-(1,3,5-trimethylpyrazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 106944585 |
| Molecular Formula | C14H16BrF2N3 |
| Molecular Weight | 344.20 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-2-(1,3,5-trimethylpyrazol-4-yl)ethanamine |
| SMILES | Cc1nn(C)c(C)c1CC(N)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C14H16BrF2N3/c1-7-9(8(2)20(3)19-7)6-12(18)13-11(16)5-4-10(15)14(13)17/h4-5,12H,6,18H2,1-3H3 |
| InChIKey | QEBWTOISENMEQA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.20 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|