C15H15N3OS — CID 106948611
6-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]isoquinolin-5-amine (PubChem CID 106948611) has the molecular formula C15H15N3OS and a molecular weight of 285.37 g/mol. Its IUPAC name is 6-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]isoquinolin-5-amine.
| Compound Name | 6-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]isoquinolin-5-amine |
|---|---|
| PubChem CID | 106948611 |
| Molecular Formula | C15H15N3OS |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 6-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]isoquinolin-5-amine |
| SMILES | Cc1ncsc1CCOc1ccc2cnccc2c1N |
| InChI | InChI=1S/C15H15N3OS/c1-10-14(20-9-18-10)5-7-19-13-3-2-11-8-17-6-4-12(11)15(13)16/h2-4,6,8-9H,5,7,16H2,1H3 |
| InChIKey | QUINQZIOIGTQSV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|