C13H13N5S2 — CID 106948830
5-(5-aminoisoquinolin-6-yl)sulfanyl-N,N-dimethyl-1,3,4-thiadiazol-2-amine (PubChem CID 106948830) has the molecular formula C13H13N5S2 and a molecular weight of 303.42 g/mol. Its IUPAC name is 5-(5-aminoisoquinolin-6-yl)sulfanyl-N,N-dimethyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(5-aminoisoquinolin-6-yl)sulfanyl-N,N-dimethyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 106948830 |
| Molecular Formula | C13H13N5S2 |
| Molecular Weight | 303.42 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 5-(5-aminoisoquinolin-6-yl)sulfanyl-N,N-dimethyl-1,3,4-thiadiazol-2-amine |
| SMILES | CN(C)c1nnc(Sc2ccc3cnccc3c2N)s1 |
| InChI | InChI=1S/C13H13N5S2/c1-18(2)12-16-17-13(20-12)19-10-4-3-8-7-15-6-5-9(8)11(10)14/h3-7H,14H2,1-2H3 |
| InChIKey | CYJVUEUPNWVGDQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|