C14H17BrN4O — CID 106949177
2-[(5-amino-3-bromoquinolin-8-yl)amino]-N-ethylpropanamide (PubChem CID 106949177) has the molecular formula C14H17BrN4O and a molecular weight of 337.22 g/mol. Its IUPAC name is 2-[(5-amino-3-bromoquinolin-8-yl)amino]-N-ethylpropanamide.
| Compound Name | 2-[(5-amino-3-bromoquinolin-8-yl)amino]-N-ethylpropanamide |
|---|---|
| PubChem CID | 106949177 |
| Molecular Formula | C14H17BrN4O |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 2-[(5-amino-3-bromoquinolin-8-yl)amino]-N-ethylpropanamide |
| SMILES | CCNC(=O)C(C)Nc1ccc(N)c2cc(Br)cnc12 |
| InChI | InChI=1S/C14H17BrN4O/c1-3-17-14(20)8(2)19-12-5-4-11(16)10-6-9(15)7-18-13(10)12/h4-8,19H,3,16H2,1-2H3,(H,17,20) |
| InChIKey | CAJOOSVEOUDURG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|