C13H15BrN4O — CID 106949644
3-[(5-amino-3-bromoquinolin-8-yl)amino]butanamide (PubChem CID 106949644) has the molecular formula C13H15BrN4O and a molecular weight of 323.19 g/mol. Its IUPAC name is 3-[(5-amino-3-bromoquinolin-8-yl)amino]butanamide.
| Compound Name | 3-[(5-amino-3-bromoquinolin-8-yl)amino]butanamide |
|---|---|
| PubChem CID | 106949644 |
| Molecular Formula | C13H15BrN4O |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 3-[(5-amino-3-bromoquinolin-8-yl)amino]butanamide |
| SMILES | CC(CC(N)=O)Nc1ccc(N)c2cc(Br)cnc12 |
| InChI | InChI=1S/C13H15BrN4O/c1-7(4-12(16)19)18-11-3-2-10(15)9-5-8(14)6-17-13(9)11/h2-3,5-7,18H,4,15H2,1H3,(H2,16,19) |
| InChIKey | GWMNXLVFESNLKU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|