C14H15BrN4O — CID 106949452
4-(5-amino-3-bromoquinolin-8-yl)-1,4-diazepan-2-one (PubChem CID 106949452) has the molecular formula C14H15BrN4O and a molecular weight of 335.20 g/mol. Its IUPAC name is 4-(5-amino-3-bromoquinolin-8-yl)-1,4-diazepan-2-one.
| Compound Name | 4-(5-amino-3-bromoquinolin-8-yl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 106949452 |
| Molecular Formula | C14H15BrN4O |
| Molecular Weight | 335.20 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 4-(5-amino-3-bromoquinolin-8-yl)-1,4-diazepan-2-one |
| SMILES | Nc1ccc(N2CCCNC(=O)C2)c2ncc(Br)cc12 |
| InChI | InChI=1S/C14H15BrN4O/c15-9-6-10-11(16)2-3-12(14(10)18-7-9)19-5-1-4-17-13(20)8-19/h2-3,6-7H,1,4-5,8,16H2,(H,17,20) |
| InChIKey | IBLIMLNJIZRNEV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.20 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|