C15H17BrN4O — CID 106949702
4-(5-amino-3-bromoquinolin-8-yl)-1-methyl-1,4-diazepan-2-one (PubChem CID 106949702) has the molecular formula C15H17BrN4O and a molecular weight of 349.23 g/mol. Its IUPAC name is 4-(5-amino-3-bromoquinolin-8-yl)-1-methyl-1,4-diazepan-2-one.
| Compound Name | 4-(5-amino-3-bromoquinolin-8-yl)-1-methyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 106949702 |
| Molecular Formula | C15H17BrN4O |
| Molecular Weight | 349.23 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 4-(5-amino-3-bromoquinolin-8-yl)-1-methyl-1,4-diazepan-2-one |
| SMILES | CN1CCCN(c2ccc(N)c3cc(Br)cnc23)CC1=O |
| InChI | InChI=1S/C15H17BrN4O/c1-19-5-2-6-20(9-14(19)21)13-4-3-12(17)11-7-10(16)8-18-15(11)13/h3-4,7-8H,2,5-6,9,17H2,1H3 |
| InChIKey | UIDBLJVRASUNQI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.23 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|