C17H22N2O — CID 106953089
2-(1-phenylcyclopentyl)-4-propan-2-yl-1,4-dihydroimidazol-5-one (PubChem CID 106953089) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is 2-(1-phenylcyclopentyl)-4-propan-2-yl-1,4-dihydroimidazol-5-one.
| Compound Name | 2-(1-phenylcyclopentyl)-4-propan-2-yl-1,4-dihydroimidazol-5-one |
|---|---|
| PubChem CID | 106953089 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 2-(1-phenylcyclopentyl)-4-propan-2-yl-1,4-dihydroimidazol-5-one |
| SMILES | CC(C)C1N=C(C2(c3ccccc3)CCCC2)NC1=O |
| InChI | InChI=1S/C17H22N2O/c1-12(2)14-15(20)19-16(18-14)17(10-6-7-11-17)13-8-4-3-5-9-13/h3-5,8-9,12,14H,6-7,10-11H2,1-2H3,(H,18,19,20) |
| InChIKey | YHYBOJAWALKQQB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |