C15H15N3O — CID 106953433
4,4-dimethyl-2-(4-methylquinolin-2-yl)-1H-imidazol-5-one (PubChem CID 106953433) has the molecular formula C15H15N3O and a molecular weight of 253.31 g/mol. Its IUPAC name is 4,4-dimethyl-2-(4-methylquinolin-2-yl)-1H-imidazol-5-one.
| Compound Name | 4,4-dimethyl-2-(4-methylquinolin-2-yl)-1H-imidazol-5-one |
|---|---|
| PubChem CID | 106953433 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 4,4-dimethyl-2-(4-methylquinolin-2-yl)-1H-imidazol-5-one |
| SMILES | Cc1cc(C2=NC(C)(C)C(=O)N2)nc2ccccc12 |
| InChI | InChI=1S/C15H15N3O/c1-9-8-12(13-17-14(19)15(2,3)18-13)16-11-7-5-4-6-10(9)11/h4-8H,1-3H3,(H,17,18,19) |
| InChIKey | JOIUWLOHPZABCZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |