C15H21NO4 — CID 106953481
5-(4-hydroxy-2,5-dimethylanilino)-3,3-dimethyl-5-oxopentanoic acid (PubChem CID 106953481) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is 5-(4-hydroxy-2,5-dimethylanilino)-3,3-dimethyl-5-oxopentanoic acid.
| Compound Name | 5-(4-hydroxy-2,5-dimethylanilino)-3,3-dimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 106953481 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 5-(4-hydroxy-2,5-dimethylanilino)-3,3-dimethyl-5-oxopentanoic acid |
| SMILES | Cc1cc(NC(=O)CC(C)(C)CC(=O)O)c(C)cc1O |
| InChI | InChI=1S/C15H21NO4/c1-9-6-12(17)10(2)5-11(9)16-13(18)7-15(3,4)8-14(19)20/h5-6,17H,7-8H2,1-4H3,(H,16,18)(H,19,20) |
| InChIKey | AZMRXPCHQLXJNR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|