C9H14ClN3O — CID 106956357
2-(1-chloroethyl)-5-piperidin-1-yl-1,3,4-oxadiazole (PubChem CID 106956357) has the molecular formula C9H14ClN3O and a molecular weight of 215.68 g/mol. Its IUPAC name is 2-(1-chloroethyl)-5-piperidin-1-yl-1,3,4-oxadiazole.
| Compound Name | 2-(1-chloroethyl)-5-piperidin-1-yl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 106956357 |
| Molecular Formula | C9H14ClN3O |
| Molecular Weight | 215.68 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 2-(1-chloroethyl)-5-piperidin-1-yl-1,3,4-oxadiazole |
| SMILES | CC(Cl)c1nnc(N2CCCCC2)o1 |
| InChI | InChI=1S/C9H14ClN3O/c1-7(10)8-11-12-9(14-8)13-5-3-2-4-6-13/h7H,2-6H2,1H3 |
| InChIKey | PUKAWPLCBZTQEE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.68 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|