C13H22ClN3O — CID 106957511
2-(4-tert-butylpiperidin-1-yl)-5-(1-chloroethyl)-1,3,4-oxadiazole (PubChem CID 106957511) has the molecular formula C13H22ClN3O and a molecular weight of 271.79 g/mol. Its IUPAC name is 2-(4-tert-butylpiperidin-1-yl)-5-(1-chloroethyl)-1,3,4-oxadiazole.
| Compound Name | 2-(4-tert-butylpiperidin-1-yl)-5-(1-chloroethyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 106957511 |
| Molecular Formula | C13H22ClN3O |
| Molecular Weight | 271.79 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 2-(4-tert-butylpiperidin-1-yl)-5-(1-chloroethyl)-1,3,4-oxadiazole |
| SMILES | CC(Cl)c1nnc(N2CCC(C(C)(C)C)CC2)o1 |
| InChI | InChI=1S/C13H22ClN3O/c1-9(14)11-15-16-12(18-11)17-7-5-10(6-8-17)13(2,3)4/h9-10H,5-8H2,1-4H3 |
| InChIKey | OBRUTHQIPFNVHO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.79 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|