C9H13ClN4O2 — CID 106957655
1-[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]-1,4-diazepan-5-one (PubChem CID 106957655) has the molecular formula C9H13ClN4O2 and a molecular weight of 244.68 g/mol. Its IUPAC name is 1-[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]-1,4-diazepan-5-one.
| Compound Name | 1-[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 106957655 |
| Molecular Formula | C9H13ClN4O2 |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 1-[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]-1,4-diazepan-5-one |
| SMILES | CC(Cl)c1nnc(N2CCNC(=O)CC2)o1 |
| InChI | InChI=1S/C9H13ClN4O2/c1-6(10)8-12-13-9(16-8)14-4-2-7(15)11-3-5-14/h6H,2-5H2,1H3,(H,11,15) |
| InChIKey | PULXGBNBIVQMKG-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|