C12H22ClN5O — CID 106957559
2-[4-[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]piperazin-1-yl]-N,N-dimethylethanamine (PubChem CID 106957559) has the molecular formula C12H22ClN5O and a molecular weight of 287.80 g/mol. Its IUPAC name is 2-[4-[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]piperazin-1-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[4-[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]piperazin-1-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 106957559 |
| Molecular Formula | C12H22ClN5O |
| Molecular Weight | 287.80 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 2-[4-[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]piperazin-1-yl]-N,N-dimethylethanamine |
| SMILES | CN(C)CCN1CCN(c2nnc(CCCl)o2)CC1 |
| InChI | InChI=1S/C12H22ClN5O/c1-16(2)5-6-17-7-9-18(10-8-17)12-15-14-11(19-12)3-4-13/h3-10H2,1-2H3 |
| InChIKey | IFJUZRNDGFDMFI-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 48.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.80 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|